Compound Q&A

What are the physical and chemical properties of 2-Bromo-3-methyl-5-nitropyridine (CAS: 23132-21-0)?

Answer

2-Bromo-3-methyl-5-nitropyridine
2-Bromo-3-methyl-5-nitropyridine is a crystalline solid with a molecular weight of approximately 223.02 g/mol. It is slightly soluble in water but soluble in organic solvents such as ethanol and acetone. The compound is known for its high reactivity, especially towards nucleophiles and reducing agents.

About

CAS No 23132-21-0
English Name 2-Bromo-3-methyl-5-nitropyridine
Molecular Formula C6H5BrN2O2
Molecular Weight 217.02 g/mol
SMILES CC1=CC(=CN=C1Br)[N+](=O)[O-]
InChIKey FZIQHPKXSLHGBZ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is 2-Bromo-3-methyl-5-nitropyridine (CAS: 23132-21-0) typically synthesized?

2-Bromo-3-methyl-5-nitropyridine is typically synthesized via the nitration of 3-methyl-2-pyridinebo...

Compound Q&A

What industries use 2-Bromo-3-methyl-5-nitropyridine (CAS: 23132-21-0)?

2-Bromo-3-methyl-5-nitropyridine is primarily used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 2-Bromo-3-methyl-5-nitropyridine (CAS: 23132-21-0)?

Handling 2-Bromo-3-methyl-5-nitropyridine requires strict safety measures due to its reactivity. Alw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...