Compound Q&A

How is 2-Bromo-3-methyl-5-nitropyridine (CAS: 23132-21-0) typically synthesized?

Answer

2-Bromo-3-methyl-5-nitropyridine
2-Bromo-3-methyl-5-nitropyridine is typically synthesized via the nitration of 3-methyl-2-pyridineboronic acid followed by bromination. This process requires careful control of reaction conditions to ensure high yield and selectivity. Commonly used reagents include nitric acid and bromine in the presence of a phase transfer catalyst.

About

CAS No 23132-21-0
English Name 2-Bromo-3-methyl-5-nitropyridine
Molecular Formula C6H5BrN2O2
Molecular Weight 217.02 g/mol
SMILES CC1=CC(=CN=C1Br)[N+](=O)[O-]
InChIKey FZIQHPKXSLHGBZ-UHFFFAOYSA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-3-methyl-5-nitropyridine (CAS: 23132-21-0)?

2-Bromo-3-methyl-5-nitropyridine is a crystalline solid with a molecular weight of approximately 223...

Compound Q&A

What industries use 2-Bromo-3-methyl-5-nitropyridine (CAS: 23132-21-0)?

2-Bromo-3-methyl-5-nitropyridine is primarily used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 2-Bromo-3-methyl-5-nitropyridine (CAS: 23132-21-0)?

Handling 2-Bromo-3-methyl-5-nitropyridine requires strict safety measures due to its reactivity. Alw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...