Compound Q&A

What precautions should be taken when handling Cefepime DiHCl (CAS: 107648-80-6)?

Answer

Cefepime DiHCl
When handling Cefepime DiHCl, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, lab coat, and safety goggles. It should be stored in a cool, dry place away from direct sunlight. In case of spills, use appropriate spill kits, and immediately consult the Safety Data Sheet (SDS) for further guidance. It is advisable to use a fume hood during preparation to minimize inhalation risks.

About

English Name Cefepime DiHCl
Molecular Formula C19H26Cl2N6O5S2
Molecular Weight 553.5 g/mol
SMILES C[N+]1(CCCC1)CC2=C(N3C(C(C3=O)NC(=O)C(=NOC)C4=CSC(=N4)N)SC2)C(=O)O.Cl.[Cl-]
InChIKey XQQAUWFZBOTKFQ-MHRNPJSASA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cefepime DiHCl (CAS: 107648-80-6)?

Cefepime DiHCl is a crystalline compound with a molecular weight of approximately 613.46 g/mol. It h...

Compound Q&A

How is Cefepime DiHCl (CAS: 107648-80-6) typically synthesized?

Cefepime DiHCl is synthesized through a multi-step process involving acylation, reduction, and amida...

Compound Q&A

What industries use Cefepime DiHCl (CAS: 107648-80-6)?

Cefepime DiHCl is primarily used in the pharmaceutical industry as an antibacterial agent. It is wid...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...