Compound Q&A

What are the physical and chemical properties of Cefepime DiHCl (CAS: 107648-80-6)?

Answer

Cefepime DiHCl
Cefepime DiHCl is a crystalline compound with a molecular weight of approximately 613.46 g/mol. It has a high solubility in water and poor solubility in organic solvents. The compound shows moderate reactivity towards basic conditions and is stable under acidic conditions. It is commonly used as an antibacterial agent and has a pH range of 2-5.

About

English Name Cefepime DiHCl
Molecular Formula C19H26Cl2N6O5S2
Molecular Weight 553.5 g/mol
SMILES C[N+]1(CCCC1)CC2=C(N3C(C(C3=O)NC(=O)C(=NOC)C4=CSC(=N4)N)SC2)C(=O)O.Cl.[Cl-]
InChIKey XQQAUWFZBOTKFQ-MHRNPJSASA-N
Last Updated: 2025-10-16 16:48

Related Q&A

Compound Q&A

How is Cefepime DiHCl (CAS: 107648-80-6) typically synthesized?

Cefepime DiHCl is synthesized through a multi-step process involving acylation, reduction, and amida...

Compound Q&A

What industries use Cefepime DiHCl (CAS: 107648-80-6)?

Cefepime DiHCl is primarily used in the pharmaceutical industry as an antibacterial agent. It is wid...

Compound Q&A

What precautions should be taken when handling Cefepime DiHCl (CAS: 107648-80-6)?

When handling Cefepime DiHCl, it is crucial to wear appropriate personal protective equipment (PPE) ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...