Compound Q&A

What industries use 5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5)?

Answer

5-fluoro-3-nitro-pyridin-2-ol
5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) finds applications in pharmaceuticals and organic synthesis, particularly in the development of novel drugs and intermediates. It is also used in the preparation of certain dyes and as a reagent in academic and industrial laboratories.

About

English Name 5-fluoro-3-nitro-pyridin-2-ol
Molecular Formula C5H3FN2O3
Molecular Weight 158.09 g/mol
SMILES C1=C(C(=O)NC=C1F)[N+](=O)[O-]
InChIKey BLFUHTOZIOQGBU-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5)?

5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) is a crystalline solid with a molecular weight of a...

Compound Q&A

How is 5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) typically synthesized?

5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) can be synthesized through the reduction of 5-nitro...

Compound Q&A

What precautions should be taken when handling 5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5)?

5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) requires careful handling due to its reactivity. Al...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...