Compound Q&A

What are the physical and chemical properties of 5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5)?

Answer

5-fluoro-3-nitro-pyridin-2-ol
5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) is a crystalline solid with a molecular weight of approximately 213.07 g/mol. It has a low solubility in water and is more soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive due to the presence of the nitro and fluoro substituents, making it useful in various chemical transformations and reactions.

About

English Name 5-fluoro-3-nitro-pyridin-2-ol
Molecular Formula C5H3FN2O3
Molecular Weight 158.09 g/mol
SMILES C1=C(C(=O)NC=C1F)[N+](=O)[O-]
InChIKey BLFUHTOZIOQGBU-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

How is 5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) typically synthesized?

5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) can be synthesized through the reduction of 5-nitro...

Compound Q&A

What industries use 5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5)?

5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) finds applications in pharmaceuticals and organic s...

Compound Q&A

What precautions should be taken when handling 5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5)?

5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) requires careful handling due to its reactivity. Al...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...