Compound Q&A

How is 5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) typically synthesized?

Answer

5-fluoro-3-nitro-pyridin-2-ol
5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) can be synthesized through the reduction of 5-nitro-3-pyridon-2-ol followed by fluorination. Common methods include using sodium borohydride for reduction and various fluorinating agents like hydrogen fluoride or fluorine gas for the fluorination step. The reaction conditions are typically optimized for high yield and selectivity.

About

English Name 5-fluoro-3-nitro-pyridin-2-ol
Molecular Formula C5H3FN2O3
Molecular Weight 158.09 g/mol
SMILES C1=C(C(=O)NC=C1F)[N+](=O)[O-]
InChIKey BLFUHTOZIOQGBU-UHFFFAOYSA-N
Last Updated: 2025-10-13 15:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5)?

5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) is a crystalline solid with a molecular weight of a...

Compound Q&A

What industries use 5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5)?

5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) finds applications in pharmaceuticals and organic s...

Compound Q&A

What precautions should be taken when handling 5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5)?

5-fluoro-3-nitro-pyridin-2-ol (CAS: 136888-20-5) requires careful handling due to its reactivity. Al...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...