Compound Q&A

What industries use 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6)?

Answer

1,2-Cyclohexanediamine, platinum complex, trans-
1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6) is widely used in the pharmaceutical industry for the synthesis of anticancer drugs. It is also utilized in the polymer industry for the production of advanced materials with improved catalytic properties. Additionally, this complex finds applications in the development of sensors for detecting various chemical species and in the manufacturing of semiconductors due to its unique electronic properties.

About

CAS No 63121-00-6
English Name 1,2-Cyclohexanediamine, platinum complex, trans-
Molecular Formula C8H14N2O4Pt
Molecular Weight 395.27 g/mol
EINECS 602-339-2
SMILES O=C1C(=O)O[Pt]2(NC3CCCCC3N2)O1
InChIKey DWAFYCQODLXJNR-UHFFFAOYSA-L
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6)?

1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6) is a crystalline solid with a mol...

Compound Q&A

How is 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6) typically synthesized?

1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6) is typically synthesized by react...

Compound Q&A

What precautions should be taken when handling 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6)?

When handling 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...