Compound Q&A

How is 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6) typically synthesized?

Answer

1,2-Cyclohexanediamine, platinum complex, trans-
1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6) is typically synthesized by reacting cisplatin with 1,2-cyclohexanediamine in a 1:1 molar ratio. The reaction is conducted under an inert atmosphere using an appropriate solvent such as dimethyl sulfoxide (DMSO). The complex forms as a trans-arrangement of the cisplatin, which can be isolated by filtration and further purified by recrystallization.

About

CAS No 63121-00-6
English Name 1,2-Cyclohexanediamine, platinum complex, trans-
Molecular Formula C8H14N2O4Pt
Molecular Weight 395.27 g/mol
EINECS 602-339-2
SMILES O=C1C(=O)O[Pt]2(NC3CCCCC3N2)O1
InChIKey DWAFYCQODLXJNR-UHFFFAOYSA-L
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6)?

1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6) is a crystalline solid with a mol...

Compound Q&A

What industries use 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6)?

1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6) is widely used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6)?

When handling 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...