Compound Q&A

What are the physical and chemical properties of 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6)?

Answer

1,2-Cyclohexanediamine, platinum complex, trans-
1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6) is a crystalline solid with a molecular weight of approximately 272.24 g/mol. It is slightly soluble in water but highly soluble in organic solvents like dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). This complex is known for its high stability and good reactivity in various catalytic processes. It shows moderate reactivity towards various functional groups and exhibits excellent selectivity in catalytic applications.

About

CAS No 63121-00-6
English Name 1,2-Cyclohexanediamine, platinum complex, trans-
Molecular Formula C8H14N2O4Pt
Molecular Weight 395.27 g/mol
EINECS 602-339-2
SMILES O=C1C(=O)O[Pt]2(NC3CCCCC3N2)O1
InChIKey DWAFYCQODLXJNR-UHFFFAOYSA-L
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6) typically synthesized?

1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6) is typically synthesized by react...

Compound Q&A

What industries use 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6)?

1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6) is widely used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6)?

When handling 1,2-Cyclohexanediamine, platinum complex, trans- (CAS: 63121-00-6), it is essential to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...