Compound Q&A

What precautions should be taken when handling (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1)?

Answer

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol
When handling (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1), it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Work should be done in a well-ventilated area or fume hood to avoid inhalation. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the SDS (Safety Data Sheet) for detailed emergency procedures and storage conditions.

About

English Name (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol
Molecular Formula C8H10N2O3
Molecular Weight 182.18 g/mol
SMILES CC1=CN=C(C(=C1[N+](=O)[O-])C)CO
InChIKey KBCDOXSSYLFMHH-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1)?

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) is a crystalline solid with a molecula...

Compound Q&A

How is (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) typically synthesized?

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) can be synthesized through a multi-ste...

Compound Q&A

What industries use (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1)?

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) is used in the pharmaceutical industry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...