Compound Q&A

What are the physical and chemical properties of (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1)?

Answer

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol
(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) is a crystalline solid with a molecular weight of approximately 228.14 g/mol. It is moderately soluble in water and organic solvents like ethanol and acetone. Chemically, it is reactive towards nucleophiles and can act as an electrophile in various organic reactions. It is stable under normal storage conditions but should be kept away from strong reducing agents and bases.

About

English Name (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol
Molecular Formula C8H10N2O3
Molecular Weight 182.18 g/mol
SMILES CC1=CN=C(C(=C1[N+](=O)[O-])C)CO
InChIKey KBCDOXSSYLFMHH-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) typically synthesized?

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) can be synthesized through a multi-ste...

Compound Q&A

What industries use (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1)?

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) is used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1)?

When handling (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...