Compound Q&A

How is (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) typically synthesized?

Answer

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol
(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) can be synthesized through a multi-step process starting with 3,5-dimethyl-4-nitropyridine. The nitro group is reduced to an amino group using a suitable reducing agent, followed by alkylation with methanol. Common catalysts include sodium methoxide, and the reaction typically yields 80-90% purity under controlled conditions.

About

English Name (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol
Molecular Formula C8H10N2O3
Molecular Weight 182.18 g/mol
SMILES CC1=CN=C(C(=C1[N+](=O)[O-])C)CO
InChIKey KBCDOXSSYLFMHH-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1)?

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) is a crystalline solid with a molecula...

Compound Q&A

What industries use (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1)?

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) is used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1)?

When handling (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...