Compound Q&A

What industries use (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1)?

Answer

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol
(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those containing pyridine derivatives. It is also utilized in the polymer industry for modifying properties of polymers, and in the chemical sensors sector for developing gas sensing devices. Its reactivity makes it a valuable intermediate in semiconductor production as well.

About

English Name (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol
Molecular Formula C8H10N2O3
Molecular Weight 182.18 g/mol
SMILES CC1=CN=C(C(=C1[N+](=O)[O-])C)CO
InChIKey KBCDOXSSYLFMHH-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1)?

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) is a crystalline solid with a molecula...

Compound Q&A

How is (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) typically synthesized?

(3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1) can be synthesized through a multi-ste...

Compound Q&A

What precautions should be taken when handling (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1)?

When handling (3,5-Dimethyl-4-nitro-2-pyridinyl)methanol (CAS: 149082-03-1), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...