Compound Q&A

What precautions should be taken when handling 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4)?

Answer

4-Chloro-3-nitrobenzaldehyde
When handling 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4), it is crucial to wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. Ensure that the work is conducted in a well-ventilated area, preferably a fume hood. In case of spillage, immediately clean up with appropriate absorbent material and follow the safety data sheet (SDS) guidelines for disposal. Always consult the SDS for specific safety information.

About

CAS No 16588-34-4
English Name 4-Chloro-3-nitrobenzaldehyde
Molecular Formula C7H4ClNO3
Molecular Weight 185.56 g/mol
SMILES C1=CC(=C(C=C1C=O)[N+](=O)[O-])Cl
InChIKey HETBKLHJEWXWBM-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4)?

4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) typically synthesized?

4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) can be synthesized by the nitration of 4-chlorobenzal...

Compound Q&A

What industries use 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4)?

4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) is used in various industries, including pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...