Compound Q&A

How is 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) typically synthesized?

Answer

4-Chloro-3-nitrobenzaldehyde
4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) can be synthesized by the nitration of 4-chlorobenzaldehyde, followed by the reduction of the nitro group to an aldehyde using a suitable reducing agent such as sodium borohydride or catalytic hydrogenation. The reaction is typically carried out under mild conditions to achieve high yield and selectivity.

About

CAS No 16588-34-4
English Name 4-Chloro-3-nitrobenzaldehyde
Molecular Formula C7H4ClNO3
Molecular Weight 185.56 g/mol
SMILES C1=CC(=C(C=C1C=O)[N+](=O)[O-])Cl
InChIKey HETBKLHJEWXWBM-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4)?

4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4)?

4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) is used in various industries, including pharmaceutic...

Compound Q&A

What precautions should be taken when handling 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4)?

When handling 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4), it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...