Compound Q&A

What industries use 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4)?

Answer

4-Chloro-3-nitrobenzaldehyde
4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of medicinal compounds. It also finds applications in the polymer industry for the preparation of functional polymers and in the semiconductor industry for the development of new materials and devices.

About

CAS No 16588-34-4
English Name 4-Chloro-3-nitrobenzaldehyde
Molecular Formula C7H4ClNO3
Molecular Weight 185.56 g/mol
SMILES C1=CC(=C(C=C1C=O)[N+](=O)[O-])Cl
InChIKey HETBKLHJEWXWBM-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4)?

4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) typically synthesized?

4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) can be synthesized by the nitration of 4-chlorobenzal...

Compound Q&A

What precautions should be taken when handling 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4)?

When handling 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4), it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...