Compound Q&A

What are the physical and chemical properties of 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4)?

Answer

4-Chloro-3-nitrobenzaldehyde
4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) is a crystalline solid with a molecular weight of approximately 202.01 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive, particularly towards nucleophiles due to the presence of the nitro and chloro groups. It is used as a precursor in various organic synthesis reactions.

About

CAS No 16588-34-4
English Name 4-Chloro-3-nitrobenzaldehyde
Molecular Formula C7H4ClNO3
Molecular Weight 185.56 g/mol
SMILES C1=CC(=C(C=C1C=O)[N+](=O)[O-])Cl
InChIKey HETBKLHJEWXWBM-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) typically synthesized?

4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) can be synthesized by the nitration of 4-chlorobenzal...

Compound Q&A

What industries use 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4)?

4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4) is used in various industries, including pharmaceutic...

Compound Q&A

What precautions should be taken when handling 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4)?

When handling 4-Chloro-3-nitrobenzaldehyde (CAS: 16588-34-4), it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...