Compound Q&A

What precautions should be taken when handling 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 362703-48-8)?

Answer

2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate
When handling 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate, wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. Store the compound in a well-ventilated area away from heat sources and incompatible materials. Use a fume hood during handling to minimize inhalation exposure. In case of a spill, immediately clean up the area using appropriate absorbent materials and consult the Safety Data Sheet (SDS) for further guidance on disposal and cleanup procedures.

About

English Name 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate
Molecular Formula C13H23NO4
Molecular Weight 257.33 g/mol
SMILES CCOC(=O)C1CCCCN1C(=O)OC(C)(C)C
InChIKey KBDNAOCLKIBYPH-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 362703-48-8)?

2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate is a white crystalline solid with a mole...

Compound Q&A

How is 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 362703-48-8) typically synthesized?

2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate is typically synthesized via esterificat...

Compound Q&A

What industries use 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 362703-48-8)?

2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate is used in the pharmaceutical industry f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...