Compound Q&A

What are the physical and chemical properties of 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 362703-48-8)?

Answer

2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate
2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate is a white crystalline solid with a molecular weight of 264.39 g/mol. It has a high solubility in organic solvents like DMF and DMSO but is only slightly soluble in water. The compound is moderately reactive, particularly towards nucleophilic substitution reactions. It does not exhibit significant thermal or hydrolytic stability under normal conditions.

About

English Name 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate
Molecular Formula C13H23NO4
Molecular Weight 257.33 g/mol
SMILES CCOC(=O)C1CCCCN1C(=O)OC(C)(C)C
InChIKey KBDNAOCLKIBYPH-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

How is 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 362703-48-8) typically synthesized?

2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate is typically synthesized via esterificat...

Compound Q&A

What industries use 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 362703-48-8)?

2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate is used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 362703-48-8)?

When handling 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate, wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...