Compound Q&A

What industries use 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 362703-48-8)?

Answer

2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate
2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also utilized in the polymer industry for the modification of polymeric materials to enhance their properties. Additionally, it has applications in the production of sensors and semiconductors due to its chemical functionality.

About

English Name 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate
Molecular Formula C13H23NO4
Molecular Weight 257.33 g/mol
SMILES CCOC(=O)C1CCCCN1C(=O)OC(C)(C)C
InChIKey KBDNAOCLKIBYPH-UHFFFAOYSA-N
Last Updated: 2025-10-07 19:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 362703-48-8)?

2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate is a white crystalline solid with a mole...

Compound Q&A

How is 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 362703-48-8) typically synthesized?

2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate is typically synthesized via esterificat...

Compound Q&A

What precautions should be taken when handling 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 362703-48-8)?

When handling 2-Ethyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate, wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...