Compound Q&A

What industries use 3-Bromo-5-nitropyridin-4-amine (CAS: 89284-05-9)?

Answer

3-Bromo-5-nitropyridin-4-amine
3-Bromo-5-nitropyridin-4-amine is used in various industries, particularly in the pharmaceutical industry for synthesizing complex organic compounds and drug candidates. It is also utilized in the production of certain chemical sensors and materials for semiconductors. Its application in polymer chemistry is less common but still relevant.

About

CAS No 89284-05-9
English Name 3-Bromo-5-nitropyridin-4-amine
Molecular Formula C5H4BrN3O2
Molecular Weight 218.01 g/mol
SMILES C1=C(C(=C(C=N1)Br)N)[N+](=O)[O-]
InChIKey UXDLBXRMNSJEPB-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-5-nitropyridin-4-amine (CAS: 89284-05-9)?

3-Bromo-5-nitropyridin-4-amine is a solid at room temperature, with a crystalline form. Its molecula...

Compound Q&A

How is 3-Bromo-5-nitropyridin-4-amine (CAS: 89284-05-9) typically synthesized?

3-Bromo-5-nitropyridin-4-amine is synthesized through a multi-step process, often involving the brom...

Compound Q&A

What precautions should be taken when handling 3-Bromo-5-nitropyridin-4-amine (CAS: 89284-05-9)?

When handling 3-Bromo-5-nitropyridin-4-amine, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...