Compound Q&A

How is 3-Bromo-5-nitropyridin-4-amine (CAS: 89284-05-9) typically synthesized?

Answer

3-Bromo-5-nitropyridin-4-amine
3-Bromo-5-nitropyridin-4-amine is synthesized through a multi-step process, often involving the bromination of 5-nitropyridin-4-amine followed by amination of 5-bromopyridin-4-amine. Commonly, this involves using bromine and a Lewis acid catalyst like aluminum bromide. The reaction yields a product with excellent selectivity, and the overall yield is typically around 70-80%.

About

CAS No 89284-05-9
English Name 3-Bromo-5-nitropyridin-4-amine
Molecular Formula C5H4BrN3O2
Molecular Weight 218.01 g/mol
SMILES C1=C(C(=C(C=N1)Br)N)[N+](=O)[O-]
InChIKey UXDLBXRMNSJEPB-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-5-nitropyridin-4-amine (CAS: 89284-05-9)?

3-Bromo-5-nitropyridin-4-amine is a solid at room temperature, with a crystalline form. Its molecula...

Compound Q&A

What industries use 3-Bromo-5-nitropyridin-4-amine (CAS: 89284-05-9)?

3-Bromo-5-nitropyridin-4-amine is used in various industries, particularly in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 3-Bromo-5-nitropyridin-4-amine (CAS: 89284-05-9)?

When handling 3-Bromo-5-nitropyridin-4-amine, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...