Compound Q&A

What are the physical and chemical properties of 3-Bromo-5-nitropyridin-4-amine (CAS: 89284-05-9)?

Answer

3-Bromo-5-nitropyridin-4-amine
3-Bromo-5-nitropyridin-4-amine is a solid at room temperature, with a crystalline form. Its molecular weight is approximately 243.02 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and dimethylformamide. The compound is moderately reactive, particularly towards nucleophilic substitution reactions. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

CAS No 89284-05-9
English Name 3-Bromo-5-nitropyridin-4-amine
Molecular Formula C5H4BrN3O2
Molecular Weight 218.01 g/mol
SMILES C1=C(C(=C(C=N1)Br)N)[N+](=O)[O-]
InChIKey UXDLBXRMNSJEPB-UHFFFAOYSA-N
Last Updated: 2025-10-01 21:42

Related Q&A

Compound Q&A

How is 3-Bromo-5-nitropyridin-4-amine (CAS: 89284-05-9) typically synthesized?

3-Bromo-5-nitropyridin-4-amine is synthesized through a multi-step process, often involving the brom...

Compound Q&A

What industries use 3-Bromo-5-nitropyridin-4-amine (CAS: 89284-05-9)?

3-Bromo-5-nitropyridin-4-amine is used in various industries, particularly in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 3-Bromo-5-nitropyridin-4-amine (CAS: 89284-05-9)?

When handling 3-Bromo-5-nitropyridin-4-amine, it is essential to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...