Compound Q&A

What precautions should be taken when handling Eupalinolide B (CAS: 877822-40-7)?

Answer

Eupalinolide B
When handling Eupalinolide B, appropriate personal protective equipment (PPE) such as gloves, lab coat, and safety goggles should be worn. It should be handled in a well-ventilated area or a fume hood to avoid inhalation of dust or vapors. Spills should be cleaned up using appropriate absorbents and disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed handling and storage information. Eupalinolide B is not highly toxic but should be handled with care to avoid skin or eye contact.

About

English Name Eupalinolide B
Molecular Formula C24H30O9
Molecular Weight 462.5 g/mol
SMILES CC1=CC2C(C(CC(=CCC1OC(=O)C)COC(=O)C)OC(=O)C(=CCO)C)C(=C)C(=O)O2
InChIKey HPWMABTYJYZFLK-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Eupalinolide B (CAS: 877822-40-7)?

Eupalinolide B is a cyclic tetrapeptide. It has a molecular weight of approximately 676.49 g/mol. It...

Compound Q&A

How is Eupalinolide B (CAS: 877822-40-7) typically synthesized?

Eupalinolide B is typically synthesized through a peptide coupling reaction. The synthesis involves ...

Compound Q&A

What industries use Eupalinolide B (CAS: 877822-40-7)?

Eupalinolide B has applications in the pharmaceutical industry, particularly in the development of n...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...