Compound Q&A

How is Eupalinolide B (CAS: 877822-40-7) typically synthesized?

Answer

Eupalinolide B
Eupalinolide B is typically synthesized through a peptide coupling reaction. The synthesis involves the stepwise addition of amino acids to a growing peptide chain using standard Fmoc solid-phase peptide synthesis methods. Commonly used coupling agents include HBTU and DIC, and the reaction is typically carried out in the presence of a base such as diisopropylethylamine (DIPEA). The yield can vary depending on the purity of starting materials and the efficiency of coupling reactions.

About

English Name Eupalinolide B
Molecular Formula C24H30O9
Molecular Weight 462.5 g/mol
SMILES CC1=CC2C(C(CC(=CCC1OC(=O)C)COC(=O)C)OC(=O)C(=CCO)C)C(=C)C(=O)O2
InChIKey HPWMABTYJYZFLK-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Eupalinolide B (CAS: 877822-40-7)?

Eupalinolide B is a cyclic tetrapeptide. It has a molecular weight of approximately 676.49 g/mol. It...

Compound Q&A

What industries use Eupalinolide B (CAS: 877822-40-7)?

Eupalinolide B has applications in the pharmaceutical industry, particularly in the development of n...

Compound Q&A

What precautions should be taken when handling Eupalinolide B (CAS: 877822-40-7)?

When handling Eupalinolide B, appropriate personal protective equipment (PPE) such as gloves, lab co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...