Compound Q&A

What are the physical and chemical properties of Eupalinolide B (CAS: 877822-40-7)?

Answer

Eupalinolide B
Eupalinolide B is a cyclic tetrapeptide. It has a molecular weight of approximately 676.49 g/mol. Its crystalline form is characterized by a melting point around 270-272°C. Eupalinolide B is poorly soluble in water but soluble in organic solvents such as methanol and DMSO. It is relatively stable under acidic and alkaline conditions but can undergo hydrolysis under basic conditions. It is reactive towards bases and can form derivatives with alcohols and amines.

About

English Name Eupalinolide B
Molecular Formula C24H30O9
Molecular Weight 462.5 g/mol
SMILES CC1=CC2C(C(CC(=CCC1OC(=O)C)COC(=O)C)OC(=O)C(=CCO)C)C(=C)C(=O)O2
InChIKey HPWMABTYJYZFLK-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

How is Eupalinolide B (CAS: 877822-40-7) typically synthesized?

Eupalinolide B is typically synthesized through a peptide coupling reaction. The synthesis involves ...

Compound Q&A

What industries use Eupalinolide B (CAS: 877822-40-7)?

Eupalinolide B has applications in the pharmaceutical industry, particularly in the development of n...

Compound Q&A

What precautions should be taken when handling Eupalinolide B (CAS: 877822-40-7)?

When handling Eupalinolide B, appropriate personal protective equipment (PPE) such as gloves, lab co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...