Compound Q&A

What industries use Eupalinolide B (CAS: 877822-40-7)?

Answer

Eupalinolide B
Eupalinolide B has applications in the pharmaceutical industry, particularly in the development of new drug candidates. It is also used in the polymer industry to modify the properties of polymers through functionalization. Additionally, it can be used in the production of sensors due to its unique chemical properties. Its reactivity towards bases and alcohols makes it useful in preparing various compounds for further research and development.

About

English Name Eupalinolide B
Molecular Formula C24H30O9
Molecular Weight 462.5 g/mol
SMILES CC1=CC2C(C(CC(=CCC1OC(=O)C)COC(=O)C)OC(=O)C(=CCO)C)C(=C)C(=O)O2
InChIKey HPWMABTYJYZFLK-UHFFFAOYSA-N
Last Updated: 2025-10-01 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Eupalinolide B (CAS: 877822-40-7)?

Eupalinolide B is a cyclic tetrapeptide. It has a molecular weight of approximately 676.49 g/mol. It...

Compound Q&A

How is Eupalinolide B (CAS: 877822-40-7) typically synthesized?

Eupalinolide B is typically synthesized through a peptide coupling reaction. The synthesis involves ...

Compound Q&A

What precautions should be taken when handling Eupalinolide B (CAS: 877822-40-7)?

When handling Eupalinolide B, appropriate personal protective equipment (PPE) such as gloves, lab co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...