Compound Q&A

What precautions should be taken when handling 5-Fluoro-2-nitroaniline (CAS: 2369-11-1)?

Answer

5-Fluoro-2-nitroaniline
When handling 5-Fluoro-2-nitroaniline (CAS: 2369-11-1), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The reaction should be carried out in a well-ventilated fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbent materials, and the area should be flushed with water. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

CAS No 2369-11-1
English Name 5-Fluoro-2-nitroaniline
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C=C1F)N)[N+](=O)[O-]
InChIKey PEDMFCHWOVJDNW-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Fluoro-2-nitroaniline (CAS: 2369-11-1)?

5-Fluoro-2-nitroaniline (CAS: 2369-11-1) is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 5-Fluoro-2-nitroaniline (CAS: 2369-11-1) typically synthesized?

5-Fluoro-2-nitroaniline (CAS: 2369-11-1) is typically synthesized by the reduction of 5-chloro-2-nit...

Compound Q&A

What industries use 5-Fluoro-2-nitroaniline (CAS: 2369-11-1)?

5-Fluoro-2-nitroaniline (CAS: 2369-11-1) is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...