Compound Q&A

What industries use 5-Fluoro-2-nitroaniline (CAS: 2369-11-1)?

Answer

5-Fluoro-2-nitroaniline
5-Fluoro-2-nitroaniline (CAS: 2369-11-1) is primarily used in the pharmaceutical industry for the synthesis of certain drug intermediates. It also finds applications in the polymer industry as a precursor for the production of advanced materials. Additionally, it is used in the development of sensors and as a research reagent in various scientific fields.

About

CAS No 2369-11-1
English Name 5-Fluoro-2-nitroaniline
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C=C1F)N)[N+](=O)[O-]
InChIKey PEDMFCHWOVJDNW-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Fluoro-2-nitroaniline (CAS: 2369-11-1)?

5-Fluoro-2-nitroaniline (CAS: 2369-11-1) is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 5-Fluoro-2-nitroaniline (CAS: 2369-11-1) typically synthesized?

5-Fluoro-2-nitroaniline (CAS: 2369-11-1) is typically synthesized by the reduction of 5-chloro-2-nit...

Compound Q&A

What precautions should be taken when handling 5-Fluoro-2-nitroaniline (CAS: 2369-11-1)?

When handling 5-Fluoro-2-nitroaniline (CAS: 2369-11-1), it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...