Compound Q&A

What are the physical and chemical properties of 5-Fluoro-2-nitroaniline (CAS: 2369-11-1)?

Answer

5-Fluoro-2-nitroaniline
5-Fluoro-2-nitroaniline (CAS: 2369-11-1) is a crystalline solid with a molecular weight of approximately 186.04 g/mol. It is virtually insoluble in water but soluble in organic solvents such as ethanol and acetonitrile. Chemically, it is highly reactive, particularly towards reducing agents and certain nucleophiles. It is known for its limited solubility and strong reactivity in various chemical reactions.

About

CAS No 2369-11-1
English Name 5-Fluoro-2-nitroaniline
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES C1=CC(=C(C=C1F)N)[N+](=O)[O-]
InChIKey PEDMFCHWOVJDNW-UHFFFAOYSA-N
Last Updated: 2025-09-28 13:06

Related Q&A

Compound Q&A

How is 5-Fluoro-2-nitroaniline (CAS: 2369-11-1) typically synthesized?

5-Fluoro-2-nitroaniline (CAS: 2369-11-1) is typically synthesized by the reduction of 5-chloro-2-nit...

Compound Q&A

What industries use 5-Fluoro-2-nitroaniline (CAS: 2369-11-1)?

5-Fluoro-2-nitroaniline (CAS: 2369-11-1) is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling 5-Fluoro-2-nitroaniline (CAS: 2369-11-1)?

When handling 5-Fluoro-2-nitroaniline (CAS: 2369-11-1), it is essential to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...