Compound Q&A

What precautions should be taken when handling 2-Chloro-6-fluorobenzoyl chloride (CAS: 79455-63-3)?

Answer

2-Chloro-6-fluorobenzoyl chloride
When handling 2-Chloro-6-fluorobenzoyl chloride, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. The substance should be handled in a well-ventilated area or a fume hood due to its reactivity. Spills should be handled according to the safety data sheet (SDS) and should be neutralized with an appropriate reagent before disposal.

About

CAS No 79455-63-3
English Name 2-Chloro-6-fluorobenzoyl chloride
Molecular Formula C7H3Cl2FO
Molecular Weight 193.004 g/mol
SMILES C1=CC(=C(C(=C1)Cl)C(=O)Cl)F
InChIKey GFNAJZAKJGKJCS-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-6-fluorobenzoyl chloride (CAS: 79455-63-3)?

2-Chloro-6-fluorobenzoyl chloride is a white or off-white crystalline solid with a molecular weight ...

Compound Q&A

How is 2-Chloro-6-fluorobenzoyl chloride (CAS: 79455-63-3) typically synthesized?

2-Chloro-6-fluorobenzoyl chloride is typically synthesized by the condensation of 2-chloro-6-fluorob...

Compound Q&A

What industries use 2-Chloro-6-fluorobenzoyl chloride (CAS: 79455-63-3)?

2-Chloro-6-fluorobenzoyl chloride is used in various industries, including pharmaceuticals for the s...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...