Compound Q&A

How is 2-Chloro-6-fluorobenzoyl chloride (CAS: 79455-63-3) typically synthesized?

Answer

2-Chloro-6-fluorobenzoyl chloride
2-Chloro-6-fluorobenzoyl chloride is typically synthesized by the condensation of 2-chloro-6-fluorobenzamide with phosgene in the presence of a catalyst like N,N-dimethylformamide (DMF). The reaction yields a single product with good selectivity and moderate to high yield, depending on the conditions.

About

CAS No 79455-63-3
English Name 2-Chloro-6-fluorobenzoyl chloride
Molecular Formula C7H3Cl2FO
Molecular Weight 193.004 g/mol
SMILES C1=CC(=C(C(=C1)Cl)C(=O)Cl)F
InChIKey GFNAJZAKJGKJCS-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-6-fluorobenzoyl chloride (CAS: 79455-63-3)?

2-Chloro-6-fluorobenzoyl chloride is a white or off-white crystalline solid with a molecular weight ...

Compound Q&A

What industries use 2-Chloro-6-fluorobenzoyl chloride (CAS: 79455-63-3)?

2-Chloro-6-fluorobenzoyl chloride is used in various industries, including pharmaceuticals for the s...

Compound Q&A

What precautions should be taken when handling 2-Chloro-6-fluorobenzoyl chloride (CAS: 79455-63-3)?

When handling 2-Chloro-6-fluorobenzoyl chloride, appropriate personal protective equipment (PPE) suc...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...