Compound Q&A

What are the physical and chemical properties of 2-Chloro-6-fluorobenzoyl chloride (CAS: 79455-63-3)?

Answer

2-Chloro-6-fluorobenzoyl chloride
2-Chloro-6-fluorobenzoyl chloride is a white or off-white crystalline solid with a molecular weight of 216.01 g/mol. It has a low solubility in water but is soluble in organic solvents like dichloromethane and acetonitrile. The compound is highly reactive, particularly towards nucleophiles, and can undergo substitution reactions.

About

CAS No 79455-63-3
English Name 2-Chloro-6-fluorobenzoyl chloride
Molecular Formula C7H3Cl2FO
Molecular Weight 193 g/mol
SMILES C1=CC(=C(C(=C1)Cl)C(=O)Cl)F
InChIKey GFNAJZAKJGKJCS-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is 2-Chloro-6-fluorobenzoyl chloride (CAS: 79455-63-3) typically synthesized?

2-Chloro-6-fluorobenzoyl chloride is typically synthesized by the condensation of 2-chloro-6-fluorob...

Compound Q&A

What industries use 2-Chloro-6-fluorobenzoyl chloride (CAS: 79455-63-3)?

2-Chloro-6-fluorobenzoyl chloride is used in various industries, including pharmaceuticals for the s...

Compound Q&A

What precautions should be taken when handling 2-Chloro-6-fluorobenzoyl chloride (CAS: 79455-63-3)?

When handling 2-Chloro-6-fluorobenzoyl chloride, appropriate personal protective equipment (PPE) suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...