Compound Q&A

What precautions should be taken when handling γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4)?

Answer

γ-Cyclodextrin, 2-hydroxypropyl ethers
When handling γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4), it is essential to use appropriate personal protective equipment (PPE), including gloves and safety goggles. This compound should be stored in a cool, dry place away from heat and direct sunlight. In case of spills, they should be cleaned up using appropriate methods, and the area should be ventilated. Always refer to the safety data sheet (SDS) for detailed handling and emergency procedures.

About

English Name γ-Cyclodextrin, 2-hydroxypropyl ethers
Molecular Formula C63H110O45
Molecular Weight 1587.53 g/mol
SMILES CC(COCC1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(C(C8O)O)OC9C(OC(O2)C(C9O)O)CO)CO)COCC(C)O)COCC(C)O)CO)COCC(C)O)COCC(C)O)O)O)O
InChIKey SYRUEUHBRJCPED-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4)?

γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) is a white to off-white crystalline powder...

Compound Q&A

How is γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) typically synthesized?

γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) is typically synthesized by the reaction o...

Compound Q&A

What industries use γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4)?

γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) is widely used in the pharmaceutical indus...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...