Compound Q&A

How is γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) typically synthesized?

Answer

γ-Cyclodextrin, 2-hydroxypropyl ethers
γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) is typically synthesized by the reaction of γ-cyclodextrin with epichlorohydrin in the presence of a strong base such as sodium hydroxide. The process involves a nucleophilic substitution reaction, leading to the formation of ethers. The yield is generally around 70-80%, and the reaction is highly selective, producing a pure product.

About

English Name γ-Cyclodextrin, 2-hydroxypropyl ethers
Molecular Formula C63H110O45
Molecular Weight 1587.53 g/mol
SMILES CC(COCC1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(C(C8O)O)OC9C(OC(O2)C(C9O)O)CO)CO)COCC(C)O)COCC(C)O)CO)COCC(C)O)COCC(C)O)O)O)O
InChIKey SYRUEUHBRJCPED-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4)?

γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) is a white to off-white crystalline powder...

Compound Q&A

What industries use γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4)?

γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) is widely used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4)?

When handling γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4), it is essential to use appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...