Compound Q&A

What industries use γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4)?

Answer

γ-Cyclodextrin, 2-hydroxypropyl ethers
γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) is widely used in the pharmaceutical industry for drug delivery systems, improving the solubility and stability of drugs. It is also utilized in the food industry for stabilizing and emulsifying food products. Additionally, it finds applications in the sensor technology for detecting specific analytes, and in the semiconductor industry for improving the performance of certain electronic components.

About

English Name γ-Cyclodextrin, 2-hydroxypropyl ethers
Molecular Formula C63H110O45
Molecular Weight 1587.53 g/mol
SMILES CC(COCC1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(C(C8O)O)OC9C(OC(O2)C(C9O)O)CO)CO)COCC(C)O)COCC(C)O)CO)COCC(C)O)COCC(C)O)O)O)O
InChIKey SYRUEUHBRJCPED-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4)?

γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) is a white to off-white crystalline powder...

Compound Q&A

How is γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) typically synthesized?

γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) is typically synthesized by the reaction o...

Compound Q&A

What precautions should be taken when handling γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4)?

When handling γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4), it is essential to use appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...