Compound Q&A

What are the physical and chemical properties of γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4)?

Answer

γ-Cyclodextrin, 2-hydroxypropyl ethers
γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) is a white to off-white crystalline powder. It has a molecular weight of approximately 1560 g/mol and is poorly soluble in water. It exhibits moderate solubility in organic solvents such as ethanol and acetone. This compound is known for its ability to form inclusion complexes with various guest molecules, making it highly reactive in certain chemical transformations.

About

English Name γ-Cyclodextrin, 2-hydroxypropyl ethers
Molecular Formula C63H110O45
Molecular Weight 1587.53 g/mol
SMILES CC(COCC1C2C(C(C(O1)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)OC5C(OC(C(C5O)O)OC6C(OC(C(C6O)O)OC7C(OC(C(C7O)O)OC8C(OC(C(C8O)O)OC9C(OC(O2)C(C9O)O)CO)CO)COCC(C)O)COCC(C)O)CO)COCC(C)O)COCC(C)O)O)O)O
InChIKey SYRUEUHBRJCPED-UHFFFAOYSA-N
Last Updated: 2025-09-16 13:49

Related Q&A

Compound Q&A

How is γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) typically synthesized?

γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) is typically synthesized by the reaction o...

Compound Q&A

What industries use γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4)?

γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4) is widely used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4)?

When handling γ-Cyclodextrin, 2-hydroxypropyl ethers (CAS: 128446-34-4), it is essential to use appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...