Compound Q&A

What precautions should be taken when handling 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7)?

Answer

3-Hydroxy-4-nitrobenzoic acid
When handling 3-Hydroxy-4-nitrobenzoic acid, it is essential to use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Handle the compound in a well-ventilated area or a fume hood to prevent inhalation. Spills should be cleaned up carefully using appropriate absorbent materials, and the area should be decontaminated. Always refer to the safety data sheet (SDS) for detailed handling procedures and emergency response instructions.

About

CAS No 619-14-7
English Name 3-Hydroxy-4-nitrobenzoic acid
Molecular Formula C7H5NO5
Molecular Weight 183.12 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)O)[N+](=O)[O-]
InChIKey XLDLRRGZWIEEHT-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7)?

3-Hydroxy-4-nitrobenzoic acid is a crystalline solid with a molecular weight of 214.08 g/mol. It has...

Compound Q&A

How is 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7) typically synthesized?

3-Hydroxy-4-nitrobenzoic acid can be synthesized via nitration of 3-hydroxybenzoic acid using concen...

Compound Q&A

What industries use 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7)?

3-Hydroxy-4-nitrobenzoic acid is used in various industries. It is a key intermediate in the synthes...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...