Compound Q&A

How is 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7) typically synthesized?

Answer

3-Hydroxy-4-nitrobenzoic acid
3-Hydroxy-4-nitrobenzoic acid can be synthesized via nitration of 3-hydroxybenzoic acid using concentrated nitric acid and sulfuric acid as the nitrating mixture. Alternatively, it can be produced by nitration of 3-hydroxybenzaldehyde followed by oxidation. The yield is around 70-80%, and the reaction is typically conducted under controlled conditions to ensure selectivity.

About

CAS No 619-14-7
English Name 3-Hydroxy-4-nitrobenzoic acid
Molecular Formula C7H5NO5
Molecular Weight 183.12 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)O)[N+](=O)[O-]
InChIKey XLDLRRGZWIEEHT-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7)?

3-Hydroxy-4-nitrobenzoic acid is a crystalline solid with a molecular weight of 214.08 g/mol. It has...

Compound Q&A

What industries use 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7)?

3-Hydroxy-4-nitrobenzoic acid is used in various industries. It is a key intermediate in the synthes...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7)?

When handling 3-Hydroxy-4-nitrobenzoic acid, it is essential to use appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...