Compound Q&A

What industries use 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7)?

Answer

3-Hydroxy-4-nitrobenzoic acid
3-Hydroxy-4-nitrobenzoic acid is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly in the production of drugs that require specific functional groups. It also finds applications in the production of dyes, pigments, and other organic materials. Additionally, it is used in the manufacturing of sensors and as a component in some polymer formulations.

About

CAS No 619-14-7
English Name 3-Hydroxy-4-nitrobenzoic acid
Molecular Formula C7H5NO5
Molecular Weight 183.12 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)O)[N+](=O)[O-]
InChIKey XLDLRRGZWIEEHT-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7)?

3-Hydroxy-4-nitrobenzoic acid is a crystalline solid with a molecular weight of 214.08 g/mol. It has...

Compound Q&A

How is 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7) typically synthesized?

3-Hydroxy-4-nitrobenzoic acid can be synthesized via nitration of 3-hydroxybenzoic acid using concen...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7)?

When handling 3-Hydroxy-4-nitrobenzoic acid, it is essential to use appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...