Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7)?

Answer

3-Hydroxy-4-nitrobenzoic acid
3-Hydroxy-4-nitrobenzoic acid is a crystalline solid with a molecular weight of 214.08 g/mol. It has a solubility of approximately 1.4 g/100 mL in water. This compound is moderately acidic and exhibits good solubility in common organic solvents like ethanol and acetone. It is relatively stable under normal conditions but can be sensitive to strong reducing agents and bases.

About

CAS No 619-14-7
English Name 3-Hydroxy-4-nitrobenzoic acid
Molecular Formula C7H5NO5
Molecular Weight 183.12 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)O)[N+](=O)[O-]
InChIKey XLDLRRGZWIEEHT-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7) typically synthesized?

3-Hydroxy-4-nitrobenzoic acid can be synthesized via nitration of 3-hydroxybenzoic acid using concen...

Compound Q&A

What industries use 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7)?

3-Hydroxy-4-nitrobenzoic acid is used in various industries. It is a key intermediate in the synthes...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-4-nitrobenzoic acid (CAS: 619-14-7)?

When handling 3-Hydroxy-4-nitrobenzoic acid, it is essential to use appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...