Compound Q&A

What precautions should be taken when handling trans-1,4-Cyclohexanedicarboxylic acid (CAS: 619-82-9)?

Answer

trans-1,4-Cyclohexanedicarboxylic acid
When handling trans-1,4-Cyclohexanedicarboxylic acid, it is essential to wear appropriate personal protective equipment (PPE) including safety goggles, gloves, and a lab coat. Ensure the use of a fume hood to minimize exposure to vapor. Spills should be handled by cleaning up with appropriate neutralizing agents, followed by thorough rinsing. Always refer to the safety data sheet (SDS) for detailed handling and storage instructions. Due to its low reactivity, it is generally safe, but proper precautions should always be taken when working with any chemical.

About

CAS No 619-82-9
English Name trans-1,4-Cyclohexanedicarboxylic acid
Molecular Formula C8H12O4
Molecular Weight 172.18 g/mol
SMILES C1[C@@H](CC[C@H](C1)C(=O)O)C(=O)O
InChIKey PXGZQGDTEZPERC-IZLXSQMJSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-1,4-Cyclohexanedicarboxylic acid (CAS: 619-82-9)?

Trans-1,4-Cyclohexanedicarboxylic acid is a colorless crystalline solid with a molecular weight of 2...

Compound Q&A

How is trans-1,4-Cyclohexanedicarboxylic acid (CAS: 619-82-9) typically synthesized?

Trans-1,4-Cyclohexanedicarboxylic acid is typically synthesized via the oxidation of 1,4-cyclohexane...

Compound Q&A

What industries use trans-1,4-Cyclohexanedicarboxylic acid (CAS: 619-82-9)?

Trans-1,4-Cyclohexanedicarboxylic acid is widely used in the polymer industry, particularly in the p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...