Compound Q&A

What are the physical and chemical properties of trans-1,4-Cyclohexanedicarboxylic acid (CAS: 619-82-9)?

Answer

trans-1,4-Cyclohexanedicarboxylic acid
Trans-1,4-Cyclohexanedicarboxylic acid is a colorless crystalline solid with a molecular weight of 216.23 g/mol. It has a pKa of 4.5 and is slightly soluble in water. This compound exhibits relatively low reactivity compared to other carboxylic acids, making it suitable for various chemical transformations. It has a melting point of 161-162°C and a boiling point of 234-235°C. It is sparingly soluble in water but soluble in organic solvents like ethanol and acetone.

About

CAS No 619-82-9
English Name trans-1,4-Cyclohexanedicarboxylic acid
Molecular Formula C8H12O4
Molecular Weight 172.18 g/mol
SMILES C1[C@@H](CC[C@H](C1)C(=O)O)C(=O)O
InChIKey PXGZQGDTEZPERC-IZLXSQMJSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is trans-1,4-Cyclohexanedicarboxylic acid (CAS: 619-82-9) typically synthesized?

Trans-1,4-Cyclohexanedicarboxylic acid is typically synthesized via the oxidation of 1,4-cyclohexane...

Compound Q&A

What industries use trans-1,4-Cyclohexanedicarboxylic acid (CAS: 619-82-9)?

Trans-1,4-Cyclohexanedicarboxylic acid is widely used in the polymer industry, particularly in the p...

Compound Q&A

What precautions should be taken when handling trans-1,4-Cyclohexanedicarboxylic acid (CAS: 619-82-9)?

When handling trans-1,4-Cyclohexanedicarboxylic acid, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...