Compound Q&A

What industries use trans-1,4-Cyclohexanedicarboxylic acid (CAS: 619-82-9)?

Answer

trans-1,4-Cyclohexanedicarboxylic acid
Trans-1,4-Cyclohexanedicarboxylic acid is widely used in the polymer industry, particularly in the production of polyesters and polyamides. It is also utilized in the pharmaceutical sector for the synthesis of certain drugs, as well as in the production of sensors and semiconductors. Its excellent thermal stability and chemical resistance make it a valuable component in various industrial applications.

About

CAS No 619-82-9
English Name trans-1,4-Cyclohexanedicarboxylic acid
Molecular Formula C8H12O4
Molecular Weight 172.18 g/mol
SMILES C1[C@@H](CC[C@H](C1)C(=O)O)C(=O)O
InChIKey PXGZQGDTEZPERC-IZLXSQMJSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-1,4-Cyclohexanedicarboxylic acid (CAS: 619-82-9)?

Trans-1,4-Cyclohexanedicarboxylic acid is a colorless crystalline solid with a molecular weight of 2...

Compound Q&A

How is trans-1,4-Cyclohexanedicarboxylic acid (CAS: 619-82-9) typically synthesized?

Trans-1,4-Cyclohexanedicarboxylic acid is typically synthesized via the oxidation of 1,4-cyclohexane...

Compound Q&A

What precautions should be taken when handling trans-1,4-Cyclohexanedicarboxylic acid (CAS: 619-82-9)?

When handling trans-1,4-Cyclohexanedicarboxylic acid, it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...