Compound Q&A

What precautions should be taken when handling 3-Quinolinylboronic acid (CAS: 191162-39-7)?

Answer

3-Quinolinylboronic acid
When handling 3-Quinolinylboronic acid, it is important to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure that the work is conducted in a well-ventilated area or under a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbent materials. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

English Name 3-Quinolinylboronic acid
Molecular Formula C9H8BNO2
Molecular Weight 172.98 g/mol
SMILES B(C1=CC2=CC=CC=C2N=C1)(O)O
InChIKey YGDICLRMNDWZAK-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Quinolinylboronic acid (CAS: 191162-39-7)?

3-Quinolinylboronic acid is a white crystalline solid with a molecular weight of approximately 267.3...

Compound Q&A

How is 3-Quinolinylboronic acid (CAS: 191162-39-7) typically synthesized?

3-Quinolinylboronic acid is typically synthesized via the reaction of 3-quinolineboronic acid and br...

Compound Q&A

What industries use 3-Quinolinylboronic acid (CAS: 191162-39-7)?

3-Quinolinylboronic acid is used in the pharmaceutical industry for the synthesis of complex molecul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...