Compound Q&A

What industries use 3-Quinolinylboronic acid (CAS: 191162-39-7)?

Answer

3-Quinolinylboronic acid
3-Quinolinylboronic acid is used in the pharmaceutical industry for the synthesis of complex molecules and compounds with bioactive properties. It is also utilized in the polymer industry for the modification of polymers and in the semiconductor industry for its use in electronic device manufacturing. Additionally, it finds applications in the development of sensors and as a chelating agent in analytical chemistry.

About

English Name 3-Quinolinylboronic acid
Molecular Formula C9H8BNO2
Molecular Weight 172.98 g/mol
SMILES B(C1=CC2=CC=CC=C2N=C1)(O)O
InChIKey YGDICLRMNDWZAK-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Quinolinylboronic acid (CAS: 191162-39-7)?

3-Quinolinylboronic acid is a white crystalline solid with a molecular weight of approximately 267.3...

Compound Q&A

How is 3-Quinolinylboronic acid (CAS: 191162-39-7) typically synthesized?

3-Quinolinylboronic acid is typically synthesized via the reaction of 3-quinolineboronic acid and br...

Compound Q&A

What precautions should be taken when handling 3-Quinolinylboronic acid (CAS: 191162-39-7)?

When handling 3-Quinolinylboronic acid, it is important to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...