Compound Q&A

What are the physical and chemical properties of 3-Quinolinylboronic acid (CAS: 191162-39-7)?

Answer

3-Quinolinylboronic acid
3-Quinolinylboronic acid is a white crystalline solid with a molecular weight of approximately 267.3 g/mol. It is moderately soluble in water and ethanol. The compound exhibits good reactivity in boronate ester formation and undergoes electrophilic aromatic substitution reactions. It is commonly used in organic synthesis and as a chelating agent.

About

English Name 3-Quinolinylboronic acid
Molecular Formula C9H8BNO2
Molecular Weight 172.98 g/mol
SMILES B(C1=CC2=CC=CC=C2N=C1)(O)O
InChIKey YGDICLRMNDWZAK-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 3-Quinolinylboronic acid (CAS: 191162-39-7) typically synthesized?

3-Quinolinylboronic acid is typically synthesized via the reaction of 3-quinolineboronic acid and br...

Compound Q&A

What industries use 3-Quinolinylboronic acid (CAS: 191162-39-7)?

3-Quinolinylboronic acid is used in the pharmaceutical industry for the synthesis of complex molecul...

Compound Q&A

What precautions should be taken when handling 3-Quinolinylboronic acid (CAS: 191162-39-7)?

When handling 3-Quinolinylboronic acid, it is important to wear appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...