Compound Q&A

What precautions should be taken when handling Fosbretabulin disodium (CAS: 168555-66-6)?

Answer

Fosbretabulin disodium
When handling Fosbretabulin disodium (CAS: 168555-66-6), wear appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation risks. Follow standard laboratory safety protocols, and store the compound in a cool, dry place away from strong acids and bases. Refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

English Name Fosbretabulin disodium
Molecular Formula C18H19Na2O8P
Molecular Weight 440.3 g/mol
SMILES COC1=C(C=C(C=C1)C=CC2=CC(=C(C(=C2)OC)OC)OC)OP(=O)([O-])[O-].[Na+].[Na+]
InChIKey VXNQMUVMEIGUJW-XNOMRPDFSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fosbretabulin disodium (CAS: 168555-66-6)?

Fosbretabulin disodium (CAS: 168555-66-6) is a crystalline compound with a molecular weight of appro...

Compound Q&A

How is Fosbretabulin disodium (CAS: 168555-66-6) typically synthesized?

Fosbretabulin disodium is typically synthesized through a multi-step process involving the conversio...

Compound Q&A

What industries use Fosbretabulin disodium (CAS: 168555-66-6)?

Fosbretabulin disodium (CAS: 168555-66-6) is primarily used in the pharmaceutical industry, specific...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...