Compound Q&A

How is Fosbretabulin disodium (CAS: 168555-66-6) typically synthesized?

Answer

Fosbretabulin disodium
Fosbretabulin disodium is typically synthesized through a multi-step process involving the conversion of the parent compound to its sodium salt. Common methods include esterification and subsequent saponification reactions, followed by crystallization under controlled conditions. The synthesis requires careful control of reaction conditions to ensure high yield and purity.

About

English Name Fosbretabulin disodium
Molecular Formula C18H19Na2O8P
Molecular Weight 440.3 g/mol
SMILES COC1=C(C=C(C=C1)C=CC2=CC(=C(C(=C2)OC)OC)OC)OP(=O)([O-])[O-].[Na+].[Na+]
InChIKey VXNQMUVMEIGUJW-XNOMRPDFSA-L
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fosbretabulin disodium (CAS: 168555-66-6)?

Fosbretabulin disodium (CAS: 168555-66-6) is a crystalline compound with a molecular weight of appro...

Compound Q&A

What industries use Fosbretabulin disodium (CAS: 168555-66-6)?

Fosbretabulin disodium (CAS: 168555-66-6) is primarily used in the pharmaceutical industry, specific...

Compound Q&A

What precautions should be taken when handling Fosbretabulin disodium (CAS: 168555-66-6)?

When handling Fosbretabulin disodium (CAS: 168555-66-6), wear appropriate personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...